Structure of PDB 5lx6 Chain B Binding Site BS01 |
|
|
Ligand ID | 78P |
InChI | InChI=1S/C13H16N4O/c1-13(6-3-7-15-13)12-16-9-5-2-4-8(11(14)18)10(9)17-12/h2,4-5,15H,3,6-7H2,1H3,(H2,14,18)(H,16,17)/t13-/m1/s1 |
InChIKey | JNAHVYVRKWKWKQ-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1(CCCN1)c2[nH]c3c(cccc3n2)C(=O)N | ACDLabs 10.04 | O=C(N)c3c1c(nc(n1)C2(NCCC2)C)ccc3 | CACTVS 3.341 | C[C]1(CCCN1)c2[nH]c3c(cccc3C(N)=O)n2 | CACTVS 3.341 | C[C@@]1(CCCN1)c2[nH]c3c(cccc3C(N)=O)n2 | OpenEye OEToolkits 1.5.0 | C[C@@]1(CCCN1)c2[nH]c3c(cccc3n2)C(=O)N |
|
Formula | C13 H16 N4 O |
Name | (2R)-2-(7-carbamoyl-1H-benzimidazol-2-yl)-2-methylpyrrolidinium; Veliparib |
ChEMBL | CHEMBL506871 |
DrugBank | DB07232 |
ZINC | ZINC000084610155
|
PDB chain | 5lx6 Chain B Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|