Structure of PDB 5lnw Chain B Binding Site BS01 |
|
|
Ligand ID | K8P |
InChI | InChI=1S/C8H16NO7P/c1-3-6(10)5(2)9-8(12)7(11)4-16-17(13,14)15/h3,5,7-9,11-12H,1,4H2,2H3,(H2,13,14,15)/t5-,7+,8+/m0/s1 |
InChIKey | UJGBYPNOGNUCKJ-UIISKDMLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | CC(C(=O)C=C)NC(C(COP(=O)(O)O)O)O | CACTVS 3.385 | C[CH](N[CH](O)[CH](O)CO[P](O)(O)=O)C(=O)C=C | CACTVS 3.385 | C[C@H](N[C@H](O)[C@H](O)CO[P](O)(O)=O)C(=O)C=C | OpenEye OEToolkits 2.0.5 | C[C@@H](C(=O)C=C)N[C@@H]([C@@H](COP(=O)(O)O)O)O |
|
Formula | C8 H16 N O7 P |
Name | [(2~{R},3~{R})-2,3-bis(oxidanyl)-3-[[(2~{S})-3-oxidanylidenepent-4-en-2-yl]amino]propyl] dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905573
|
PDB chain | 5lnw Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.3.3.6: pyridoxal 5'-phosphate synthase (glutamine hydrolyzing). |
|
|
|