Structure of PDB 5l4w Chain B Binding Site BS01 |
|
|
Ligand ID | 6KH |
InChI | InChI=1S/C13H25FO5/c1-2-3-4-5-6-7-18-13-12(17)10(14)11(16)9(8-15)19-13/h9-13,15-17H,2-8H2,1H3/t9-,10+,11-,12+,13+/m1/s1 |
InChIKey | ZEXHYSKAVKHNNT-FHUSYTEZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCCO[CH]1O[CH](CO)[CH](O)[CH](F)[CH]1O | OpenEye OEToolkits 2.0.5 | CCCCCCCOC1C(C(C(C(O1)CO)O)F)O | CACTVS 3.385 | CCCCCCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](F)[C@@H]1O | OpenEye OEToolkits 2.0.5 | CCCCCCCO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)F)O |
|
Formula | C13 H25 F O5 |
Name | heptyl 3-fluoro-alpha-D-mannopyranoside; 3-Fluoro-Heptylmannoside; heptyl 3-fluoro-alpha-D-mannoside; heptyl 3-fluoro-D-mannoside; heptyl 3-fluoro-mannoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5l4w Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|