Structure of PDB 5kz8 Chain B Binding Site BS01 |
|
|
Ligand ID | 6Z5 |
InChI | InChI=1S/C23H20N4O2/c1-23(2)17-13-24-22(25-14-7-4-3-5-8-14)26-20(17)27(21(23)29)18-12-11-16-15(18)9-6-10-19(16)28/h3-13,18,28H,1-2H3,(H,24,25,26)/t18-/m0/s1 |
InChIKey | XYYZSCWSVMFLOM-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | CC1(c2cnc(nc2N(C1=O)[C@H]3C=Cc4c3cccc4O)Nc5ccccc5)C | CACTVS 3.385 | CC1(C)C(=O)N([C@H]2C=Cc3c(O)cccc23)c4nc(Nc5ccccc5)ncc14 | OpenEye OEToolkits 2.0.5 | CC1(c2cnc(nc2N(C1=O)C3C=Cc4c3cccc4O)Nc5ccccc5)C | CACTVS 3.385 | CC1(C)C(=O)N([CH]2C=Cc3c(O)cccc23)c4nc(Nc5ccccc5)ncc14 |
|
Formula | C23 H20 N4 O2 |
Name | 5,5-dimethyl-7-[(1~{S})-4-oxidanyl-1~{H}-inden-1-yl]-2-phenylazanyl-pyrrolo[2,3-d]pyrimidin-6-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5kz8 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|