Structure of PDB 5klx Chain B Binding Site BS01 |
|
|
Ligand ID | 6UO |
InChI | InChI=1S/C21H24N2O6S/c24-20(18-9-6-11-22-15-18)28-13-14-29-21(25)19-10-4-5-12-23(19)30(26,27)16-17-7-2-1-3-8-17/h1-3,6-9,11,15,19H,4-5,10,12-14,16H2/t19-/m0/s1 |
InChIKey | KUWLHSSIHRTCQU-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1ccc(cc1)CS(=O)(=O)N2CCCC[C@H]2C(=O)OCCOC(=O)c3cccnc3 | OpenEye OEToolkits 2.0.5 | c1ccc(cc1)CS(=O)(=O)N2CCCCC2C(=O)OCCOC(=O)c3cccnc3 | CACTVS 3.385 | O=C(OCCOC(=O)c1cccnc1)[C@@H]2CCCCN2[S](=O)(=O)Cc3ccccc3 | CACTVS 3.385 | O=C(OCCOC(=O)c1cccnc1)[CH]2CCCCN2[S](=O)(=O)Cc3ccccc3 |
|
Formula | C21 H24 N2 O6 S |
Name | 2-[(2~{S})-1-(phenylmethyl)sulfonylpiperidin-2-yl]carbonyloxyethyl pyridine-3-carboxylate |
ChEMBL | CHEMBL3930292 |
DrugBank | |
ZINC |
|
PDB chain | 5klx Chain B Residue 200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|