Structure of PDB 5jvd Chain B Binding Site BS01 |
|
|
Ligand ID | 6NL |
InChI | InChI=1S/C19H18O6/c1-11(6-12-4-5-15(22-2)14(20)7-12)18(21)13-8-16(23-3)19-17(9-13)24-10-25-19/h4-9,20H,10H2,1-3H3/b11-6+ |
InChIKey | IYAYDNORGNGYOF-IZZDOVSWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC(=Cc1ccc(c(c1)O)OC)C(=O)c2cc3c(c(c2)OC)OCO3 | OpenEye OEToolkits 2.0.4 | C/C(=C\c1ccc(c(c1)O)OC)/C(=O)c2cc3c(c(c2)OC)OCO3 | CACTVS 3.385 | COc1ccc(\C=C(/C)C(=O)c2cc(OC)c3OCOc3c2)cc1O | ACDLabs 12.01 | COc1c(O)cc(cc1)[C@H]=C(C)C(=O)c2cc(c3c(c2)OCO3)OC | CACTVS 3.385 | COc1ccc(C=C(C)C(=O)c2cc(OC)c3OCOc3c2)cc1O |
|
Formula | C19 H18 O6 |
Name | (2E)-3-(3-hydroxy-4-methoxyphenyl)-1-(7-methoxy-2H-1,3-benzodioxol-5-yl)-2-methylprop-2-en-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904725
|
PDB chain | 5jvd Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|