Structure of PDB 5jsq Chain B Binding Site BS01 |
|
|
Ligand ID | 6MS |
InChI | InChI=1S/C11H18N5O4P/c12-11-14-9-8(10(17)15-11)13-7-16(9)5-3-1-2-4-6-21(18,19)20/h7H,1-6H2,(H2,18,19,20)(H3,12,14,15,17) |
InChIKey | CULYTKHWSUTBGY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | c1nc2c(n1CCCCCCP(=O)(O)O)N=C(NC2=O)N | CACTVS 3.385 | NC1=Nc2n(CCCCCC[P](O)(O)=O)cnc2C(=O)N1 | ACDLabs 12.01 | C(CCCCCP(O)(=O)O)n2c1N=C(NC(=O)c1nc2)N |
|
Formula | C11 H18 N5 O4 P |
Name | [6-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)hexyl]phosphonic acid; 9-[7-(phosphonoheptyl]guanine |
ChEMBL | CHEMBL1928784 |
DrugBank | |
ZINC | ZINC000082150634
|
PDB chain | 5jsq Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|