Structure of PDB 5jq9 Chain B Binding Site BS01 |
|
|
Ligand ID | 6MB |
InChI | InChI=1S/C18H18N8O4S/c1-9-10(2)25-30-17(9)26-31(28,29)13-5-3-11(4-6-13)20-7-12-8-21-15-14(22-12)16(27)24-18(19)23-15/h3-6,8,20,26H,7H2,1-2H3,(H3,19,21,23,24,27) |
InChIKey | JJZFSJXETRBCPR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1noc(N[S](=O)(=O)c2ccc(NCc3cnc4N=C(N)NC(=O)c4n3)cc2)c1C | ACDLabs 12.01 | c12nc(cnc1N=C(NC2=O)N)CNc3ccc(cc3)S(Nc4onc(c4C)C)(=O)=O | OpenEye OEToolkits 2.0.4 | Cc1c(noc1NS(=O)(=O)c2ccc(cc2)NCc3cnc4c(n3)C(=O)NC(=N4)N)C |
|
Formula | C18 H18 N8 O4 S |
Name | 4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzene-1-sulfonamide |
ChEMBL | CHEMBL3828532 |
DrugBank | |
ZINC | ZINC000584904730
|
PDB chain | 5jq9 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K221 R255 |
Catalytic site (residue number reindexed from 1) |
K197 R231 |
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|