Structure of PDB 5jo0 Chain B Binding Site BS01 |
|
|
Ligand ID | L56 |
InChI | InChI=1S/C15H24NO5P/c1-12-5-3-6-13(9-12)7-4-8-14(11-22(19,20)21)10-15(17)16(2)18/h3,5-6,9,14,18H,4,7-8,10-11H2,1-2H3,(H2,19,20,21)/t14-/m1/s1 |
InChIKey | LKGTWQXFDFYGBW-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(O)C(=O)C[CH](CCCc1cccc(C)c1)C[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)CC(CC(=O)N(C)O)CCCc1cc(ccc1)C | OpenEye OEToolkits 2.0.4 | Cc1cccc(c1)CCCC(CC(=O)N(C)O)CP(=O)(O)O | OpenEye OEToolkits 2.0.4 | Cc1cccc(c1)CCC[C@H](CC(=O)N(C)O)CP(=O)(O)O | CACTVS 3.385 | CN(O)C(=O)C[C@@H](CCCc1cccc(C)c1)C[P](O)(O)=O |
|
Formula | C15 H24 N O5 P |
Name | [(2R)-2-{2-[hydroxy(methyl)amino]-2-oxoethyl}-5-(3-methylphenyl)pentyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905591
|
PDB chain | 5jo0 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|