Structure of PDB 5jbi Chain B Binding Site BS01 |
|
|
Ligand ID | 6J8 |
InChI | InChI=1S/C15H24NO6P/c1-16(18)15(17)10-13(11-23(19,20)21)5-3-4-12-6-8-14(22-2)9-7-12/h6-9,13,18H,3-5,10-11H2,1-2H3,(H2,19,20,21)/t13-/m1/s1 |
InChIKey | QEUMCKOMQCGMBO-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CN(C(=O)CC(CCCc1ccc(cc1)OC)CP(=O)(O)O)O | OpenEye OEToolkits 2.0.4 | CN(C(=O)C[C@@H](CCCc1ccc(cc1)OC)CP(=O)(O)O)O | CACTVS 3.385 | COc1ccc(CCC[CH](CC(=O)N(C)O)C[P](O)(O)=O)cc1 | ACDLabs 12.01 | C(C(CC(=O)N(C)O)CCCc1ccc(OC)cc1)P(O)(O)=O | CACTVS 3.385 | COc1ccc(CCC[C@H](CC(=O)N(C)O)C[P](O)(O)=O)cc1 |
|
Formula | C15 H24 N O6 P |
Name | [(2R)-2-{2-[hydroxy(methyl)amino]-2-oxoethyl}-5-(4-methoxyphenyl)pentyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904818
|
PDB chain | 5jbi Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|