Structure of PDB 5j42 Chain B Binding Site BS01 |
|
|
Ligand ID | 6FV |
InChI | InChI=1S/C18H10N4O3/c19-9-10-1-2-11-8-14-16(20-18(25)21-17(14)24)22(15(11)7-10)12-3-5-13(23)6-4-12/h1-8,23H,(H,21,24,25) |
InChIKey | JAOMIQIQBBRLQX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc(cc1)N2c3cc(ccc3C=C4C(=O)NC(=O)N=C24)C#N | OpenEye OEToolkits 2.0.4 | c1cc(ccc1N2c3cc(ccc3C=C4C2=NC(=O)NC4=O)C#N)O | ACDLabs 12.01 | N3C(C2=Cc4c(N(c1ccc(cc1)O)C2=NC3=O)cc(cc4)C#N)=O |
|
Formula | C18 H10 N4 O3 |
Name | 10-(4-hydroxyphenyl)-2,4-dioxo-2,3,4,10-tetrahydropyrimido[4,5-b]quinoline-8-carbonitrile |
ChEMBL | CHEMBL2420465 |
DrugBank | |
ZINC | ZINC000096282702
|
PDB chain | 5j42 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|