Structure of PDB 5itp Chain B Binding Site BS01 |
|
|
Ligand ID | 6DB |
InChI | InChI=1S/C9H18N4O4/c1-5(7(14)15)13-6(8(16)17)3-2-4-12-9(10)11/h5-6,13H,2-4H2,1H3,(H,14,15)(H,16,17)(H4,10,11,12)/t5-,6+/m1/s1 |
InChIKey | IMXSCCDUAFEIOE-RITPCOANSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC(C(=O)O)NC(CCCNC(=N)N)C(=O)O | ACDLabs 12.01 | O=C(O)C(NC(C(O)=O)CCCN\C(=N)N)C | OpenEye OEToolkits 2.0.4 | [H]/N=C(/N)\NCCC[C@@H](C(=O)O)N[C@H](C)C(=O)O | CACTVS 3.385 | C[C@@H](N[C@@H](CCCNC(N)=N)C(O)=O)C(O)=O | CACTVS 3.385 | C[CH](N[CH](CCCNC(N)=N)C(O)=O)C(O)=O |
|
Formula | C9 H18 N4 O4 |
Name | octopine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001529867
|
PDB chain | 5itp Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|