Structure of PDB 5ime Chain B Binding Site BS01 |
|
|
Ligand ID | 6BZ |
InChI | InChI=1S/C22H22ClN7O2/c1-13-20(31)29(9-7-26-13)15-4-5-16(18(23)11-15)17-10-14-12-27-22(25-2)28-19(14)30(21(17)32)8-3-6-24/h4-5,7,9-12H,3,6,8,24H2,1-2H3,(H,25,27,28) |
InChIKey | VTJYENUZSYEIJD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c2c(N1C=CN=C(C1=O)C)ccc(c2Cl)C=3C(N(c4c(C=3)cnc(n4)NC)CCCN)=O | CACTVS 3.385 | CNc1ncc2C=C(C(=O)N(CCCN)c2n1)c3ccc(cc3Cl)N4C=CN=C(C)C4=O | OpenEye OEToolkits 2.0.4 | CC1=NC=CN(C1=O)c2ccc(c(c2)Cl)C3=Cc4cnc(nc4N(C3=O)CCCN)NC |
|
Formula | C22 H22 Cl N7 O2 |
Name | 8-(3-aminopropyl)-6-[2-chloro-4-(3-methyl-2-oxopyrazin-1(2H)-yl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7(8H)-one |
ChEMBL | CHEMBL3818592 |
DrugBank | |
ZINC | ZINC000584904882
|
PDB chain | 5ime Chain B Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|