Structure of PDB 5htz Chain B Binding Site BS01 |
|
|
Ligand ID | 66J |
InChI | InChI=1S/C17H17ClN4O2S2/c1-4-5-11-6-12(9-20-8-11)14-7-13(18)15(25-14)17(2)10-26(23,24)22(3)16(19)21-17/h6-9H,10H2,1-3H3,(H2,19,21)/t17-/m0/s1 |
InChIKey | VKVMIZCLMUKTTA-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC#Cc1cncc(c1)c2sc(c(Cl)c2)[C]3(C)C[S](=O)(=O)N(C)C(=N)N3 | CACTVS 3.385 | CC#Cc1cncc(c1)c2sc(c(Cl)c2)[C@]3(C)C[S](=O)(=O)N(C)C(=N)N3 | ACDLabs 12.01 | c3(c2cc(c(C1(C)CS(N(\C(=N)N1)C)(=O)=O)s2)Cl)cc(C#CC)cnc3 | OpenEye OEToolkits 2.0.4 | CC#Cc1cc(cnc1)c2cc(c(s2)C3(CS(=O)(=O)N(C(=N)N3)C)C)Cl | OpenEye OEToolkits 2.0.4 | [H]/N=C/1\N[C@](CS(=O)(=O)N1C)(C)c2c(cc(s2)c3cc(cnc3)C#CC)Cl |
|
Formula | C17 H17 Cl N4 O2 S2 |
Name | (3E,5S)-5-{3-chloro-5-[5-(prop-1-yn-1-yl)pyridin-3-yl]thiophen-2-yl}-2,5-dimethyl-1,2,4-thiadiazinan-3-imine 1,1-dioxide |
ChEMBL | CHEMBL3259832 |
DrugBank | |
ZINC | ZINC000144605596
|
PDB chain | 5htz Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|