Structure of PDB 5hn8 Chain B Binding Site BS01 |
|
|
Ligand ID | HXK |
InChI | InChI=1S/C22H28O4S/c1-2-3-4-5-6-9-12-26-19-14-17(13-18(23)15-19)16-27-21-11-8-7-10-20(21)22(24)25/h7-8,10-11,13-15,23H,2-6,9,12,16H2,1H3,(H,24,25) |
InChIKey | VWFBKLSSSBBNHA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCCCCCOc1cc(O)cc(CSc2ccccc2C(O)=O)c1 | ACDLabs 12.01 | O=C(O)c2ccccc2SCc1cc(O)cc(OCCCCCCCC)c1 | OpenEye OEToolkits 1.7.2 | CCCCCCCCOc1cc(cc(c1)O)CSc2ccccc2C(=O)O |
|
Formula | C22 H28 O4 S |
Name | 2-{[3-hydroxy-5-(octyloxy)benzyl]sulfanyl}benzoic acid; BPH-1182 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905774
|
PDB chain | 5hn8 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|