Structure of PDB 5g10 Chain B Binding Site BS01 |
|
|
Ligand ID | 6DK |
InChI | InChI=1S/C15H20F3NO3/c16-15(17,18)14(21,22)11-7-2-1-6-10-13(20)19-12-8-4-3-5-9-12/h3-5,8-9,21-22H,1-2,6-7,10-11H2,(H,19,20) |
InChIKey | DOVGAPNVSPZBAT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1ccc(cc1)NC(=O)CCCCCCC(C(F)(F)F)(O)O | CACTVS 3.385 | OC(O)(CCCCCCC(=O)Nc1ccccc1)C(F)(F)F |
|
Formula | C15 H20 F3 N O3 |
Name | 9,9,9-tris(fluoranyl)-8,8-bis(oxidanyl)-~{N}-phenyl-nonanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904690
|
PDB chain | 5g10 Chain A Residue 1375
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|