Structure of PDB 5fq9 Chain B Binding Site BS01 |
|
|
Ligand ID | C6S |
InChI | InChI=1S/C16H20BNO5/c19-15(10-5-2-1-3-6-10)18-13-9-11-7-4-8-12(16(20)21)14(11)23-17(13)22/h4,7-8,10,13,22H,1-3,5-6,9H2,(H,18,19)(H,20,21)/t13-/m0/s1 |
InChIKey | ZRHUJXRVIMMHFG-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | B1([C@H](Cc2cccc(c2O1)C(=O)O)NC(=O)C3CCCCC3)O | CACTVS 3.385 | OB1Oc2c(C[CH]1NC(=O)C3CCCCC3)cccc2C(O)=O | CACTVS 3.385 | OB1Oc2c(C[C@@H]1NC(=O)C3CCCCC3)cccc2C(O)=O | OpenEye OEToolkits 1.7.6 | B1(C(Cc2cccc(c2O1)C(=O)O)NC(=O)C3CCCCC3)O |
|
Formula | C16 H20 B N O5 |
Name | (3R)-3-(cyclohexylcarbonylamino)-2-oxidanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
ChEMBL | CHEMBL5283816 |
DrugBank | |
ZINC | ZINC000584905536
|
PDB chain | 5fq9 Chain B Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|