Structure of PDB 5fd2 Chain B Binding Site BS01 |
|
|
Ligand ID | 5XJ |
InChI | InChI=1S/C18H16F2N8O2S/c1-28(2)31(29,30)27-12-6-5-11(19)15(13(12)20)26-17-10(4-3-7-21-17)14-16-18(24-8-22-14)25-9-23-16/h3-9,27H,1-2H3,(H,21,26)(H,22,23,24,25) |
InChIKey | DFMZBEXLPWVTSV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)[S](=O)(=O)Nc1ccc(F)c(Nc2ncccc2c3ncnc4nc[nH]c34)c1F | OpenEye OEToolkits 2.0.4 | CN(C)S(=O)(=O)Nc1ccc(c(c1F)Nc2c(cccn2)c3c4c(nc[nH]4)ncn3)F |
|
Formula | C18 H16 F2 N8 O2 S |
Name | 6-[2-[[3-(dimethylsulfamoylamino)-2,6-bis(fluoranyl)phenyl]amino]pyridin-3-yl]-7~{H}-purine |
ChEMBL | CHEMBL3798256 |
DrugBank | |
ZINC | ZINC000584905181
|
PDB chain | 5fd2 Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|