Structure of PDB 5f03 Chain B Binding Site BS01 |
|
|
Ligand ID | 5TA |
InChI | InChI=1S/C24H20ClN3O3/c25-23-19(6-3-11-27-23)10-9-17-4-1-7-20(12-17)28-15-22(31-24(28)29)16-30-21-8-2-5-18(13-21)14-26/h1-8,11-13,22H,14-16,26H2/t22-/m0/s1 |
InChIKey | DALBYXAUBIFWAM-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NCc1cccc(OC[CH]2CN(C(=O)O2)c3cccc(c3)C#Cc4cccnc4Cl)c1 | OpenEye OEToolkits 2.0.4 | c1cc(cc(c1)OCC2CN(C(=O)O2)c3cccc(c3)C#Cc4cccnc4Cl)CN | OpenEye OEToolkits 2.0.4 | c1cc(cc(c1)OC[C@@H]2CN(C(=O)O2)c3cccc(c3)C#Cc4cccnc4Cl)CN | CACTVS 3.385 | NCc1cccc(OC[C@@H]2CN(C(=O)O2)c3cccc(c3)C#Cc4cccnc4Cl)c1 |
|
Formula | C24 H20 Cl N3 O3 |
Name | (5~{S})-5-[[3-(aminomethyl)phenoxy]methyl]-3-[3-[2-(2-chloranylpyridin-3-yl)ethynyl]phenyl]-1,3-oxazolidin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905179
|
PDB chain | 5f03 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|