Structure of PDB 5ek9 Chain B Binding Site BS01 |
|
|
Ligand ID | 5P4 |
InChI | InChI=1S/C20H24N2O4/c1-12(2)26-20(24)21-17-10-13(3)22(14(4)23)18-8-7-15(11-16(17)18)19-6-5-9-25-19/h5-9,11-13,17H,10H2,1-4H3,(H,21,24)/t13-,17+/m0/s1 |
InChIKey | OZBRAEGGHPSXJE-SUMWQHHRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)OC(=O)N[CH]1C[CH](C)N(C(C)=O)c2ccc(cc12)c3occc3 | OpenEye OEToolkits 2.0.4 | CC1CC(c2cc(ccc2N1C(=O)C)c3ccco3)NC(=O)OC(C)C | CACTVS 3.385 | CC(C)OC(=O)N[C@@H]1C[C@H](C)N(C(C)=O)c2ccc(cc12)c3occc3 | OpenEye OEToolkits 2.0.4 | C[C@H]1C[C@H](c2cc(ccc2N1C(=O)C)c3ccco3)NC(=O)OC(C)C |
|
Formula | C20 H24 N2 O4 |
Name | propan-2-yl ~{N}-[(2~{S},4~{R})-1-ethanoyl-6-(furan-2-yl)-2-methyl-3,4-dihydro-2~{H}-quinolin-4-yl]carbamate |
ChEMBL | CHEMBL4209110 |
DrugBank | |
ZINC | ZINC000584904835
|
PDB chain | 5ek9 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|