Structure of PDB 5du6 Chain B Binding Site BS01 |
|
|
Ligand ID | G59 |
InChI | InChI=1S/C23H25FN4O/c1-3-16-4-8-18(9-5-16)21-12-15(2)28-22(27-21)20(14-26-28)23(29)25-13-17-6-10-19(24)11-7-17/h4-11,14-15,21,27H,3,12-13H2,1-2H3,(H,25,29)/t15-,21-/m1/s1 |
InChIKey | CVQMYJIZDVAJAR-QVKFZJNVSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c3c1n(C(CC(N1)c2ccc(cc2)CC)C)nc3)NCc4ccc(cc4)F | OpenEye OEToolkits 1.9.2 | CCc1ccc(cc1)[C@H]2C[C@H](n3c(c(cn3)C(=O)NCc4ccc(cc4)F)N2)C | CACTVS 3.385 | CCc1ccc(cc1)[C@H]2C[C@@H](C)n3ncc(C(=O)NCc4ccc(F)cc4)c3N2 | CACTVS 3.385 | CCc1ccc(cc1)[CH]2C[CH](C)n3ncc(C(=O)NCc4ccc(F)cc4)c3N2 | OpenEye OEToolkits 1.9.2 | CCc1ccc(cc1)C2CC(n3c(c(cn3)C(=O)NCc4ccc(cc4)F)N2)C |
|
Formula | C23 H25 F N4 O |
Name | (5R,7R)-5-(4-ethylphenyl)-N-(4-fluorobenzyl)-7-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620330
|
PDB chain | 5du6 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|