Structure of PDB 5ais Chain B Binding Site BS01 |
|
|
Ligand ID | CWC |
InChI | InChI=1S/C19H22N4O/c1-23(2)10-4-7-19(24)22-15-11-14(12-20-13-15)16-5-3-6-18-17(16)8-9-21-18/h3,5-6,8-9,11-13,21H,4,7,10H2,1-2H3,(H,22,24) |
InChIKey | QVBOWRMZONBBIK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc3cc(c1cccc2c1ccn2)cnc3)CCCN(C)C | OpenEye OEToolkits 1.7.6 | CN(C)CCCC(=O)Nc1cc(cnc1)c2cccc3c2cc[nH]3 | CACTVS 3.385 | CN(C)CCCC(=O)Nc1cncc(c1)c2cccc3[nH]ccc23 |
|
Formula | C19 H22 N4 O |
Name | 4-(dimethylamino)-N-[5-(1H-indol-4-yl)pyridin-3-yl]butanamide |
ChEMBL | CHEMBL3425950 |
DrugBank | |
ZINC | ZINC000230520996
|
PDB chain | 5ais Chain B Residue 1200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|