Structure of PDB 5aav Chain B Binding Site BS01 |
|
|
Ligand ID | GW5 |
InChI | InChI=1S/C25H22O2/c1-2-23(20-9-5-3-6-10-20)25(21-11-7-4-8-12-21)22-16-13-19(14-17-22)15-18-24(26)27/h3-18H,2H2,1H3,(H,26,27)/b18-15+,25-23- |
InChIKey | HJQQVNIORAQATK-DDJBQNAASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | CC/C(=C(\c1ccccc1)/c2ccc(cc2)/C=C/C(=O)O)/c3ccccc3 | CACTVS 3.385 | CCC(c1ccccc1)=C(c2ccccc2)c3ccc(C=CC(O)=O)cc3 | CACTVS 3.385 | CCC(/c1ccccc1)=C(\c2ccccc2)c3ccc(\C=C\C(O)=O)cc3 | ACDLabs 10.04 | O=C(O)\C=C\c3ccc(\C(=C(/c1ccccc1)CC)c2ccccc2)cc3 | OpenEye OEToolkits 1.7.5 | CCC(=C(c1ccccc1)c2ccc(cc2)C=CC(=O)O)c3ccccc3 |
|
Formula | C25 H22 O2 |
Name | (2E)-3-{4-[(1E)-1,2-DIPHENYLBUT-1-ENYL]PHENYL}ACRYLIC ACID; GW5638; DPC 974 |
ChEMBL | CHEMBL33899 |
DrugBank | |
ZINC |
|
PDB chain | 5aav Chain B Residue 1546
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|