Structure of PDB 5a4c Chain B Binding Site BS01 |
|
|
Ligand ID | XOJ |
InChI | InChI=1S/C27H39N7O3/c1-8-34(9-2)12-10-11-28-25-29-17-19-15-22(18-13-20(36-6)16-21(14-18)37-7)24(30-23(19)31-25)32-26(35)33-27(3,4)5/h13-17H,8-12H2,1-7H3,(H3,28,29,30,31,32,33,35) |
InChIKey | JZVDJULPDILYDY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN(CC)CCCNc1ncc2cc(c(NC(=O)NC(C)(C)C)nc2n1)c3cc(OC)cc(OC)c3 | OpenEye OEToolkits 1.7.6 | CCN(CC)CCCNc1ncc2cc(c(nc2n1)NC(=O)NC(C)(C)C)c3cc(cc(c3)OC)OC |
|
Formula | C27 H39 N7 O3 |
Name | 1-tert-butyl-3-[2-[3-(diethylamino)propylamino]-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620634
|
PDB chain | 5a4c Chain B Residue 1772
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|