Structure of PDB 4zu5 Chain B Binding Site BS01 |
|
|
Ligand ID | PXN |
InChI | InChI=1S/C17H36O8/c1-13(18)5-22-9-17(10-23-6-14(2)19,11-24-7-15(3)20)12-25-8-16(4)21/h13-16,18-21H,5-12H2,1-4H3/t13-,14-,15-,16+/m1/s1 |
InChIKey | GXEZGLLPFFKHGE-FPCVCCKLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C[C@H](COCC(COC[C@@H](C)O)(COC[C@@H](C)O)COC[C@H](C)O)O | CACTVS 3.370 | C[C@@H](O)COC[C@](COC[C@H](C)O)(COC[C@@H](C)O)COC[C@@H](C)O | OpenEye OEToolkits 1.7.0 | CC(COCC(COCC(C)O)(COCC(C)O)COCC(C)O)O | ACDLabs 12.01 | O(CC(O)C)CC(COCC(O)C)(COCC(O)C)COCC(O)C | CACTVS 3.370 | C[CH](O)COC[C](COC[CH](C)O)(COC[CH](C)O)COC[CH](C)O |
|
Formula | C17 H36 O8 |
Name | (2S)-1-[3-{[(2R)-2-hydroxypropyl]oxy}-2,2-bis({[(2R)-2-hydroxypropyl]oxy}methyl)propoxy]propan-2-ol; PENTAERYTHRITOL PROPOXYLATE (5/4 PO/OH) |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4zu5 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|