Structure of PDB 4yht Chain B Binding Site BS01 |
|
|
Ligand ID | 4EF |
InChI | InChI=1S/C17H19ClN6O3S/c1-19-28(25,26)11-2-3-14(24-4-6-27-7-5-24)13(8-11)23-17-15-12(18)9-20-16(15)21-10-22-17/h2-3,8-10,19H,4-7H2,1H3,(H2,20,21,22,23) |
InChIKey | LINMNMJCBXXKNC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c43c(Nc2c(N1CCOCC1)ccc(c2)S(=O)(=O)NC)ncnc3ncc4Cl | OpenEye OEToolkits 1.9.2 | CNS(=O)(=O)c1ccc(c(c1)Nc2c3c(c[nH]c3ncn2)Cl)N4CCOCC4 | CACTVS 3.385 | CN[S](=O)(=O)c1ccc(N2CCOCC2)c(Nc3ncnc4[nH]cc(Cl)c34)c1 |
|
Formula | C17 H19 Cl N6 O3 S |
Name | 3-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methyl-4-(morpholin-4-yl)benzenesulfonamide |
ChEMBL | CHEMBL3814798 |
DrugBank | |
ZINC | ZINC000204911638
|
PDB chain | 4yht Chain B Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|