Structure of PDB 4yc8 Chain B Binding Site BS01 |
|
|
Ligand ID | 4B7 |
InChI | InChI=1S/C27H29N7O3S/c1-19-29-24(17-25(30-19)34-13-11-33(12-14-34)15-16-35)32-27-28-18-23(38-27)26(36)31-20-7-9-22(10-8-20)37-21-5-3-2-4-6-21/h2-10,17-18,35H,11-16H2,1H3,(H,31,36)(H,28,29,30,32) |
InChIKey | QUFCHHSHOLSVOT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1nc(Nc2sc(cn2)C(=O)Nc3ccc(Oc4ccccc4)cc3)cc(n1)N5CCN(CCO)CC5 | OpenEye OEToolkits 1.9.2 | Cc1nc(cc(n1)N2CCN(CC2)CCO)Nc3ncc(s3)C(=O)Nc4ccc(cc4)Oc5ccccc5 | ACDLabs 12.01 | O=C(c1sc(nc1)Nc3nc(nc(N2CCN(CCO)CC2)c3)C)Nc5ccc(Oc4ccccc4)cc5 |
|
Formula | C27 H29 N7 O3 S |
Name | 2-({6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl}amino)-N-(4-phenoxyphenyl)-1,3-thiazole-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904646
|
PDB chain | 4yc8 Chain B Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|