Structure of PDB 4y67 Chain B Binding Site BS01 |
|
|
Ligand ID | RC5 |
InChI | InChI=1S/C14H22NO5P/c1-15(17)14(16)10-13(11-21(18,19)20)9-5-8-12-6-3-2-4-7-12/h2-4,6-7,13,17H,5,8-11H2,1H3,(H2,18,19,20)/t13-/m1/s1 |
InChIKey | YKRNADVNYIPUET-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(O)C(=O)C[C@@H](CCCc1ccccc1)C[P](O)(O)=O | CACTVS 3.385 | CN(O)C(=O)C[CH](CCCc1ccccc1)C[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)CC(CCCc1ccccc1)CC(=O)N(O)C | OpenEye OEToolkits 1.9.2 | CN(C(=O)C[C@@H](CCCc1ccccc1)CP(=O)(O)O)O | OpenEye OEToolkits 1.9.2 | CN(C(=O)CC(CCCc1ccccc1)CP(=O)(O)O)O |
|
Formula | C14 H22 N O5 P |
Name | [(2R)-2-{2-[hydroxy(methyl)amino]-2-oxoethyl}-5-phenylpentyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230570823
|
PDB chain | 4y67 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|