Structure of PDB 4y1z Chain B Binding Site BS01 |
|
|
Ligand ID | 6C2 |
InChI | InChI=1S/C9H15NO7/c1-3(11)10-4-5(12)6(13)7(8(14)15)17-9(4)16-2/h4-7,9,12-13H,1-2H3,(H,10,11)(H,14,15)/t4-,5-,6+,7+,9-/m1/s1 |
InChIKey | HPXHVBAASZCSSR-CRYJZLASSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC1C(OC(C(C1O)NC(=O)C)OC)C(O)=O | OpenEye OEToolkits 1.9.2 | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC)C(=O)O)O)O | OpenEye OEToolkits 1.9.2 | CC(=O)NC1C(C(C(OC1OC)C(=O)O)O)O | CACTVS 3.385 | CO[CH]1O[CH]([CH](O)[CH](O)[CH]1NC(C)=O)C(O)=O | CACTVS 3.385 | CO[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1NC(C)=O)C(O)=O |
|
Formula | C9 H15 N O7 |
Name | methyl 2-acetamido-2-deoxy-beta-D-glucopyranosiduronic acid; methyl 2-(acetylamino)-2-deoxy-beta-D-glucopyranosiduronic acid; methyl 2-acetamido-2-deoxy-beta-D-glucosiduronic acid; methyl 2-acetamido-2-deoxy-D-glucosiduronic acid; methyl 2-acetamido-2-deoxy-glucosiduronic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904713
|
PDB chain | 4y1z Chain D Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|