Structure of PDB 4xx3 Chain B Binding Site BS01 |
|
|
Ligand ID | 70X |
InChI | InChI=1S/C23H28N4O2/c1-16(2)23(3)13-20(28)27(22(24)26-23)15-18-10-7-11-19(12-18)21(29)25-14-17-8-5-4-6-9-17/h4-12,16H,13-15H2,1-3H3,(H2,24,26)(H,25,29)/t23-/m0/s1 |
InChIKey | OFTSPVADFMQIGQ-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[C@]1(C)CC(=O)N(Cc2cccc(c2)C(=O)NCc3ccccc3)C(=N)N1 | CACTVS 3.385 | CC(C)[C]1(C)CC(=O)N(Cc2cccc(c2)C(=O)NCc3ccccc3)C(=N)N1 | OpenEye OEToolkits 1.9.2 | CC(C)C1(CC(=O)N(C(=N)N1)Cc2cccc(c2)C(=O)NCc3ccccc3)C | OpenEye OEToolkits 1.9.2 | [H]/N=C\1/N[C@](CC(=O)N1Cc2cccc(c2)C(=O)NCc3ccccc3)(C)C(C)C | ACDLabs 12.01 | O=C(NCc1ccccc1)c2cc(ccc2)CN3C(=[N@H])NC(CC3=O)(C)C(C)C |
|
Formula | C23 H28 N4 O2 |
Name | N-benzyl-3-{[(2Z,4S)-2-imino-4-methyl-6-oxo-4-(propan-2-yl)tetrahydropyrimidin-1(2H)-yl]methyl}benzamide |
ChEMBL | CHEMBL3401341 |
DrugBank | |
ZINC | ZINC000148337314
|
PDB chain | 4xx3 Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|