Structure of PDB 4x7i Chain B Binding Site BS01 |
|
|
Ligand ID | 3YS |
InChI | InChI=1S/C18H16F2N4O2S/c19-11-1-4-15(22-6-11)16(25)23-12-2-3-14(20)13(5-12)18-9-26-7-10(18)8-27-17(21)24-18/h1-6,10H,7-9H2,(H2,21,24)(H,23,25)/t10-,18-/m0/s1 |
InChIKey | NIDRNVHMMDAAIK-YPMLDQLKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=N[C]2(COC[CH]2CS1)c3cc(NC(=O)c4ccc(F)cn4)ccc3F | CACTVS 3.385 | NC1=N[C@]2(COC[C@H]2CS1)c3cc(NC(=O)c4ccc(F)cn4)ccc3F | ACDLabs 12.01 | Fc1ccc(nc1)C(=O)Nc2cc(c(F)cc2)C43N=C(SCC3COC4)N | OpenEye OEToolkits 1.9.2 | c1cc(c(cc1NC(=O)c2ccc(cn2)F)[C@]34COC[C@H]3CSC(=N4)N)F | OpenEye OEToolkits 1.9.2 | c1cc(c(cc1NC(=O)c2ccc(cn2)F)C34COCC3CSC(=N4)N)F |
|
Formula | C18 H16 F2 N4 O2 S |
Name | N-{3-[(4aS,7aS)-2-amino-4a,5-dihydro-4H-furo[3,4-d][1,3]thiazin-7a(7H)-yl]-4-fluorophenyl}-5-fluoropyridine-2-carboxamide |
ChEMBL | CHEMBL2396989 |
DrugBank | DB12547 |
ZINC | ZINC000070466423
|
PDB chain | 4x7i Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|