Structure of PDB 4x69 Chain B Binding Site BS01 |
|
|
Ligand ID | OP0 |
InChI | InChI=1S/C9H18N4O7S/c10-3-4-19-12-9(15)8-2-1-7(5-13(8)6-14)11-20-21(16,17)18/h6-8,11H,1-5,10H2,(H,12,15)(H,16,17,18)/t7-,8+/m1/s1 |
InChIKey | YTAWXXHGLPATIN-SFYZADRCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=CN1C(C(=O)NOCCN)CCC(NOS(=O)(=O)O)C1 | OpenEye OEToolkits 1.9.2 | C1C[C@H](N(C[C@@H]1NOS(=O)(=O)O)C=O)C(=O)NOCCN | OpenEye OEToolkits 1.9.2 | C1CC(N(CC1NOS(=O)(=O)O)C=O)C(=O)NOCCN | CACTVS 3.385 | NCCONC(=O)[CH]1CC[CH](CN1C=O)NO[S](O)(=O)=O | CACTVS 3.385 | NCCONC(=O)[C@@H]1CC[C@H](CN1C=O)NO[S](O)(=O)=O |
|
Formula | C9 H18 N4 O7 S |
Name | (2S,5R)-N-(2-aminoethoxy)-1-formyl-5-[(sulfooxy)amino]piperidine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621307
|
PDB chain | 4x69 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|