Structure of PDB 4wv9 Chain B Binding Site BS01 |
|
|
Ligand ID | MD4 |
InChI | InChI=1S/C16H22N5/c1-21(2)14-3-4-15(21)10-13(9-14)20-11-16(18-19-20)12-5-7-17-8-6-12/h5-8,11,13-15H,3-4,9-10H2,1-2H3/q+1/t13-,14-,15+ |
InChIKey | IRDLJZVYUZKXLE-QKDCVEJESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[N+]1([C@@H]2CC[C@H]1CC(C2)n3cc(nn3)c4ccncc4)C | ACDLabs 12.01 | n1nn(cc1c2ccncc2)C4CC3CCC([N+]3(C)C)C4 | CACTVS 3.385 | C[N+]1(C)[C@@H]2CC[C@H]1CC(C2)n3cc(nn3)c4ccncc4 | CACTVS 3.385 | C[N+]1(C)[CH]2CC[CH]1CC(C2)n3cc(nn3)c4ccncc4 | OpenEye OEToolkits 1.9.2 | C[N+]1(C2CCC1CC(C2)n3cc(nn3)c4ccncc4)C |
|
Formula | C16 H22 N5 |
Name | (3-exo)-8,8-dimethyl-3-[4-(pyridin-4-yl)-1H-1,2,3-triazol-1-yl]-8-azoniabicyclo[3.2.1]octane |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620566
|
PDB chain | 4wv9 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|