Structure of PDB 4wot Chain B Binding Site BS01 |
|
|
Ligand ID | 3SG |
InChI | InChI=1S/C28H22F2N4O4/c1-38-28(37)19-7-8-22(29)25(13-19)34-26(35)17-4-2-3-16(11-17)21-12-18(5-6-20(21)14-31)27(36)33-24-9-10-32-15-23(24)30/h2-13,15H,14,31H2,1H3,(H,34,35)(H,32,33,36) |
InChIKey | OZKJLTGMZXEHHT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)c1ccc(F)c(NC(=O)c2cccc(c2)c3cc(ccc3CN)C(=O)Nc4ccncc4F)c1 | OpenEye OEToolkits 1.9.2 | COC(=O)c1ccc(c(c1)NC(=O)c2cccc(c2)c3cc(ccc3CN)C(=O)Nc4ccncc4F)F | ACDLabs 12.01 | Fc4c(NC(=O)c3ccc(c(c2cccc(C(=O)Nc1cc(C(=O)OC)ccc1F)c2)c3)CN)ccnc4 |
|
Formula | C28 H22 F2 N4 O4 |
Name | methyl 3-[({2'-(aminomethyl)-5'-[(3-fluoropyridin-4-yl)carbamoyl]biphenyl-3-yl}carbonyl)amino]-4-fluorobenzoate |
ChEMBL | CHEMBL3426633 |
DrugBank | |
ZINC | ZINC000206416193
|
PDB chain | 4wot Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|