Structure of PDB 4s2b Chain B Binding Site BS01 |
|
|
Ligand ID | 44S |
InChI | InChI=1S/C6H13O8P/c7-3-1-5(9)14-6(3)4(8)2-13-15(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4-,5-,6-/m1/s1 |
InChIKey | YKPKUODDXPUHGL-KVTDHHQDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[CH]1C[CH](O)[CH](O1)[CH](O)CO[P](O)(O)=O | CACTVS 3.385 | O[C@H]1C[C@@H](O)[C@@H](O1)[C@H](O)CO[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)OCC(O)C1OC(O)CC1O | OpenEye OEToolkits 1.7.6 | C1[C@H]([C@@H](O[C@H]1O)[C@@H](COP(=O)(O)O)O)O | OpenEye OEToolkits 1.7.6 | C1C(C(OC1O)C(COP(=O)(O)O)O)O |
|
Formula | C6 H13 O8 P |
Name | 2-deoxy-6-O-phosphono-beta-D-lyxo-hexofuranose; tagatose-6-phosphate, bound form; 2-deoxy-6-O-phosphono-beta-D-lyxo-hexose; 2-deoxy-6-O-phosphono-D-lyxo-hexose; 2-deoxy-6-O-phosphono-lyxo-hexose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621282
|
PDB chain | 4s2b Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|