Structure of PDB 4r8y Chain B Binding Site BS01 |
|
|
Ligand ID | 3KO |
InChI | InChI=1S/C24H40N4O2/c1-27-22(30)24(26-23(27)25,13-11-18-7-3-2-4-8-18)16-20-12-14-28(17-20)21(29)15-19-9-5-6-10-19/h18-20H,2-17H2,1H3,(H2,25,26)/t20-,24-/m1/s1 |
InChIKey | ZROUWOKUKKGJPH-HYBUGGRVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=N)N[C@](CCC2CCCCC2)(C[C@H]3CCN(C3)C(=O)CC4CCCC4)C1=O | CACTVS 3.385 | CN1C(=N)N[C](CCC2CCCCC2)(C[CH]3CCN(C3)C(=O)CC4CCCC4)C1=O | ACDLabs 12.01 | O=C(N3CCC(CC1(C(=O)N(C(=[N@H])N1)C)CCC2CCCCC2)C3)CC4CCCC4 | OpenEye OEToolkits 1.7.6 | CN1C(=O)C(NC1=N)(CCC2CCCCC2)CC3CCN(C3)C(=O)CC4CCCC4 | OpenEye OEToolkits 1.7.6 | [H]/N=C/1\N[C@](C(=O)N1C)(CCC2CCCCC2)C[C@H]3CCN(C3)C(=O)CC4CCCC4 |
|
Formula | C24 H40 N4 O2 |
Name | (2E,5R)-5-(2-cyclohexylethyl)-5-{[(3R)-1-(cyclopentylacetyl)pyrrolidin-3-yl]methyl}-2-imino-3-methylimidazolidin-4-one |
ChEMBL | CHEMBL3354247 |
DrugBank | |
ZINC | ZINC000137577170
|
PDB chain | 4r8y Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|