Structure of PDB 4r6e Chain B Binding Site BS01 |
|
|
Ligand ID | 3JD |
InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/t14-/m1/s1 |
InChIKey | PCHKPVIQAHNQLW-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc2cn(nc2c(c1)C(=O)N)c3ccc(cc3)[C@@H]4CCCNC4 | CACTVS 3.385 | NC(=O)c1cccc2cn(nc12)c3ccc(cc3)[C@@H]4CCCNC4 | OpenEye OEToolkits 1.7.6 | c1cc2cn(nc2c(c1)C(=O)N)c3ccc(cc3)C4CCCNC4 | CACTVS 3.385 | NC(=O)c1cccc2cn(nc12)c3ccc(cc3)[CH]4CCCNC4 | ACDLabs 12.01 | O=C(c1cccc2cn(nc12)c3ccc(cc3)C4CCCNC4)N |
|
Formula | C19 H20 N4 O |
Name | 2-{4-[(3S)-piperidin-3-yl]phenyl}-2H-indazole-7-carboxamide; Niraparib |
ChEMBL | CHEMBL1094636 |
DrugBank | DB11793 |
ZINC | ZINC000043206370
|
PDB chain | 4r6e Chain B Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|