Structure of PDB 4pyv Chain B Binding Site BS01 |
|
|
Ligand ID | 2XF |
InChI | InChI=1S/C21H29Cl2N3O3/c1-21(2,3)29-20(28)25-15-9-14(10-24-11-15)19(27)26(16-7-8-16)12-13-5-4-6-17(22)18(13)23/h4-6,14-16,24H,7-12H2,1-3H3,(H,25,28)/t14-,15+/m1/s1 |
InChIKey | VPHFZAIDKCROMZ-CABCVRRESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(C)OC(=O)N[CH]1CNC[CH](C1)C(=O)N(Cc2cccc(Cl)c2Cl)C3CC3 | CACTVS 3.385 | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H](C1)C(=O)N(Cc2cccc(Cl)c2Cl)C3CC3 | OpenEye OEToolkits 1.7.6 | CC(C)(C)OC(=O)NC1CC(CNC1)C(=O)N(Cc2cccc(c2Cl)Cl)C3CC3 | OpenEye OEToolkits 1.7.6 | CC(C)(C)OC(=O)N[C@H]1C[C@H](CNC1)C(=O)N(Cc2cccc(c2Cl)Cl)C3CC3 | ACDLabs 12.01 | Clc1cccc(c1Cl)CN(C(=O)C2CNCC(NC(=O)OC(C)(C)C)C2)C3CC3 |
|
Formula | C21 H29 Cl2 N3 O3 |
Name | tert-butyl {(3S,5R)-5-[cyclopropyl(2,3-dichlorobenzyl)carbamoyl]piperidin-3-yl}carbamate |
ChEMBL | CHEMBL3318932 |
DrugBank | |
ZINC | ZINC000146548910
|
PDB chain | 4pyv Chain B Residue 1000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|