Structure of PDB 4oqm Chain B Binding Site BS01 |
|
|
Ligand ID | FDU |
InChI | InChI=1S/C11H11FN2O5/c1-2-5-3-14(11(18)13-9(5)17)10-7(12)8(16)6(4-15)19-10/h1,3,6-8,10,15-16H,4H2,(H,13,17,18)/t6-,7+,8-,10-/m1/s1 |
InChIKey | YEEGMPUOCRQFRV-IBCQBUCCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[CH]1O[CH]([CH](F)[CH]1O)N2C=C(C#C)C(=O)NC2=O | ACDLabs 12.01 | O=C1NC(=O)N(C=C1C#C)C2OC(C(O)C2F)CO | CACTVS 3.370 | OC[C@H]1O[C@H]([C@@H](F)[C@@H]1O)N2C=C(C#C)C(=O)NC2=O | OpenEye OEToolkits 1.7.6 | C#CC1=CN(C(=O)NC1=O)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F | OpenEye OEToolkits 1.7.6 | C#CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)F |
|
Formula | C11 H11 F N2 O5 |
Name | 1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-ethynylpyrimidine-2,4(1H,3H)-dione; (2'S)-2'-DEOXY-2'-FLUORO-5-ETHYNYLURIDINE |
ChEMBL | CHEMBL2368299 |
DrugBank | |
ZINC | ZINC000026721200
|
PDB chain | 4oqm Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|