Structure of PDB 4onc Chain B Binding Site BS01 |
|
|
Ligand ID | 40B |
InChI | InChI=1S/C19H18O7P2/c20-19(27(21,22)23,28(24,25)26)18-11-5-10-17(13-18)16-9-4-8-15(12-16)14-6-2-1-3-7-14/h1-13,20H,(H2,21,22,23)(H2,24,25,26) |
InChIKey | QLUPVXJJKKYIHH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2cccc(c2)c3cccc(c3)C(O)(P(=O)(O)O)P(=O)(O)O | ACDLabs 12.01 | O=P(O)(O)C(O)(c1cccc(c1)c3cccc(c2ccccc2)c3)P(=O)(O)O | CACTVS 3.370 | OC(c1cccc(c1)c2cccc(c2)c3ccccc3)([P](O)(O)=O)[P](O)(O)=O |
|
Formula | C19 H18 O7 P2 |
Name | [hydroxy(1,1':3',1''-terphenyl-3-yl)methanediyl]bis(phosphonic acid) |
ChEMBL | CHEMBL215413 |
DrugBank | |
ZINC | ZINC000035049988
|
PDB chain | 4onc Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D76 H93 I187 |
Catalytic site (residue number reindexed from 1) |
D62 H79 I173 |
Enzyme Commision number |
2.5.1.86: trans,polycis-decaprenyl diphosphate synthase. 2.5.1.87: ditrans,polycis-polyprenyl diphosphate synthase [(2E,6E)-farnesyl diphosphate specific]. |
|
|
|