Structure of PDB 4old Chain B Binding Site BS01 |
|
|
Ligand ID | 2UZ |
InChI | InChI=1S/C7H10N2O4S/c8-4(7(12)13)5-9-3(6(10)11)1-2-14-5/h1,4-5,9H,2,8H2,(H,10,11)(H,12,13)/t4-,5+/m0/s1 |
InChIKey | ILCKCFSUIJSDAX-CRCLSJGQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1C=C(NC(S1)C(C(=O)O)N)C(=O)O | CACTVS 3.370 | N[C@@H]([C@@H]1NC(=CCS1)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(N)C1SCC=C(C(=O)O)N1 | CACTVS 3.370 | N[CH]([CH]1NC(=CCS1)C(O)=O)C(O)=O |
|
Formula | C7 H10 N2 O4 S |
Name | (2R)-2-[(R)-amino(carboxy)methyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid; (6R,7R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, hydrolyzed form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103524497
|
PDB chain | 4old Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|