Structure of PDB 4okp Chain B Binding Site BS01 |
|
|
Ligand ID | 2V0 |
InChI | InChI=1S/C8H12N2O4S/c1-3-2-15-6(4(9)7(11)12)10-5(3)8(13)14/h4,6,10H,2,9H2,1H3,(H,11,12)(H,13,14)/t4-,6+/m0/s1 |
InChIKey | WFPVQOKEJDXMTD-UJURSFKZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1=C(N[CH](SC1)[CH](N)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | CC1=C(NC(SC1)C(C(=O)O)N)C(=O)O | OpenEye OEToolkits 1.7.6 | CC1=C(N[C@H](SC1)[C@@H](C(=O)O)N)C(=O)O | CACTVS 3.385 | CC1=C(N[C@H](SC1)[C@H](N)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(N)C1SCC(=C(C(=O)O)N1)C |
|
Formula | C8 H12 N2 O4 S |
Name | (2R)-2-[(R)-amino(carboxy)methyl]-5-methyl-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid; 7-aminodeacetoxycephalosporanic acid, hydrolyzed form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103524509
|
PDB chain | 4okp Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|