Structure of PDB 4od9 Chain B Binding Site BS01 |
|
|
Ligand ID | 2RZ |
InChI | InChI=1S/C29H34N4O6/c1-36-23-12-10-20(15-25(23)38-3)17-27(34)33-29(30)32-22(14-19-8-6-5-7-9-19)28(35)31-18-21-11-13-24(37-2)26(16-21)39-4/h5-13,15-16,22H,14,17-18H2,1-4H3,(H,31,35)(H3,30,32,33,34)/t22-/m1/s1 |
InChIKey | IZIUZEPBXLRZLW-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NC(=[N@H])NC(C(=O)NCc1cc(OC)c(OC)cc1)Cc2ccccc2)Cc3ccc(OC)c(OC)c3 | OpenEye OEToolkits 1.7.6 | COc1ccc(cc1OC)CC(=O)NC(=N)NC(Cc2ccccc2)C(=O)NCc3ccc(c(c3)OC)OC | CACTVS 3.385 | COc1ccc(CNC(=O)[CH](Cc2ccccc2)NC(=N)NC(=O)Cc3ccc(OC)c(OC)c3)cc1OC | OpenEye OEToolkits 1.7.6 | [H]/N=C(\N[C@H](Cc1ccccc1)C(=O)NCc2ccc(c(c2)OC)OC)/NC(=O)Cc3ccc(c(c3)OC)OC | CACTVS 3.385 | COc1ccc(CNC(=O)[C@@H](Cc2ccccc2)NC(=N)NC(=O)Cc3ccc(OC)c(OC)c3)cc1OC |
|
Formula | C29 H34 N4 O6 |
Name | N-(3,4-dimethoxybenzyl)-Nalpha-{N-[(3,4-dimethoxyphenyl)acetyl]carbamimidoyl}-D-phenylalaninamide |
ChEMBL | CHEMBL3321925 |
DrugBank | |
ZINC | ZINC000098208253
|
PDB chain | 4od9 Chain A Residue 103
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D231 T234 |
Catalytic site (residue number reindexed from 1) |
D125 T128 |
Enzyme Commision number |
3.4.23.5: cathepsin D. |
|
|
|