Structure of PDB 4nt0 Chain B Binding Site BS01 |
|
|
Ligand ID | 3DU |
InChI | InChI=1S/C10H14NO9P/c12-5-1-2-11(7(13)3-5)10-9(15)8(14)6(20-10)4-19-21(16,17)18/h1-3,6,8-10,12,14-15H,4H2,(H2,16,17,18)/t6-,8-,9-,10-/m1/s1 |
InChIKey | BMAAJONJGSMHCR-PEBGCTIMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(O)(O)OCC2OC(N1C(=O)C=C(O)C=C1)C(O)C2O | OpenEye OEToolkits 1.7.6 | C1=CN(C(=O)C=C1O)C2C(C(C(O2)COP(=O)(O)O)O)O | CACTVS 3.385 | O[C@H]1[C@@H](O)[C@@H](O[C@@H]1CO[P](O)(O)=O)N2C=CC(=CC2=O)O | OpenEye OEToolkits 1.7.6 | C1=CN(C(=O)C=C1O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)O)O)O | CACTVS 3.385 | O[CH]1[CH](O)[CH](O[CH]1CO[P](O)(O)=O)N2C=CC(=CC2=O)O |
|
Formula | C10 H14 N O9 P |
Name | 4-hydroxy-1-(5-O-phosphono-beta-D-ribofuranosyl)pyridin-2(1H)-one; 3-deazauridine 5'-monophosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013517513
|
PDB chain | 4nt0 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K42 D70 K72 D75 |
Catalytic site (residue number reindexed from 1) |
K41 D69 K71 D74 |
Enzyme Commision number |
4.1.1.23: orotidine-5'-phosphate decarboxylase. |
|
|
|