Structure of PDB 4nsy Chain B Binding Site BS01 |
|
|
Ligand ID | 2OY |
InChI | InChI=1S/C14H23ClN2O3S/c1-11-5-7-12(8-6-11)21(19,20)17-13(14(18)10-15)4-2-3-9-16/h5-8,13-14,17-18H,2-4,9-10,16H2,1H3/t13-,14+/m0/s1 |
InChIKey | HBYAITRXPLQDLO-UONOGXRCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(NC(CCCCN)C(O)CCl)c1ccc(cc1)C | CACTVS 3.385 | Cc1ccc(cc1)[S](=O)(=O)N[C@@H](CCCCN)[C@H](O)CCl | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)S(=O)(=O)NC(CCCCN)C(CCl)O | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)S(=O)(=O)N[C@@H](CCCCN)[C@@H](CCl)O | CACTVS 3.385 | Cc1ccc(cc1)[S](=O)(=O)N[CH](CCCCN)[CH](O)CCl |
|
Formula | C14 H23 Cl N2 O3 S |
Name | N-[(2S,3S)-7-amino-1-chloro-2-hydroxyheptan-3-yl]-4-methylbenzenesulfonamide (Bound Form); Tosyllysine Chloromethyl Ketone (Bound Form) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208227
|
PDB chain | 4nsy Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.50: lysyl endopeptidase. |
|
|
|