Structure of PDB 4nmh Chain B Binding Site BS01 |
|
|
Ligand ID | 2KG |
InChI | InChI=1S/C19H21NO4S/c1-19(2)17(15-10-5-6-11-16(15)24-3)20(18(19)21)13-8-7-9-14(12-13)25(4,22)23/h5-12,17H,1-4H3/t17-/m0/s1 |
InChIKey | JTEHJTAGXBHCOJ-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccccc1[CH]2N(c3cccc(c3)[S](C)(=O)=O)C(=O)C2(C)C | ACDLabs 12.01 | O=S(=O)(c1cccc(c1)N3C(=O)C(C3c2ccccc2OC)(C)C)C | OpenEye OEToolkits 1.7.6 | CC1([C@@H](N(C1=O)c2cccc(c2)S(=O)(=O)C)c3ccccc3OC)C | CACTVS 3.385 | COc1ccccc1[C@@H]2N(c3cccc(c3)[S](C)(=O)=O)C(=O)C2(C)C | OpenEye OEToolkits 1.7.6 | CC1(C(N(C1=O)c2cccc(c2)S(=O)(=O)C)c3ccccc3OC)C |
|
Formula | C19 H21 N O4 S |
Name | (4S)-4-(2-methoxyphenyl)-3,3-dimethyl-1-[3-(methylsulfonyl)phenyl]azetidin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208189
|
PDB chain | 4nmh Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|