Structure of PDB 4n87 Chain B Binding Site BS01 |
|
|
Ligand ID | GBJ |
InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
InChIKey | LBQIJVLKGVZRIW-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(C=Cc2c(ccc3c2OCC(C3)c4ccc(cc4O)O)O1)C | CACTVS 3.385 | CC1(C)Oc2ccc3C[C@@H](COc3c2C=C1)c4ccc(O)cc4O | CACTVS 3.385 | CC1(C)Oc2ccc3C[CH](COc3c2C=C1)c4ccc(O)cc4O | ACDLabs 12.01 | O4c2c1C=CC(Oc1ccc2CC(c3ccc(O)cc3O)C4)(C)C | OpenEye OEToolkits 1.7.6 | CC1(C=Cc2c(ccc3c2OC[C@H](C3)c4ccc(cc4O)O)O1)C |
|
Formula | C20 H20 O4 |
Name | 4-[(3R)-8,8-dimethyl-3,4-dihydro-2H,8H-pyrano[2,3-f]chromen-3-yl]benzene-1,3-diol; glabridin |
ChEMBL | CHEMBL480477 |
DrugBank | |
ZINC | ZINC000004098719
|
PDB chain | 4n87 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|