Structure of PDB 4m3q Chain B Binding Site BS01 |
|
|
Ligand ID | 24K |
InChI | InChI=1S/C19H27N5O/c1-2-3-11-21-19-22-13-16(17-6-4-5-12-20-17)18(24-19)23-14-7-9-15(25)10-8-14/h4-6,12-15,25H,2-3,7-11H2,1H3,(H2,21,22,23,24)/t14-,15- |
InChIKey | DMDQOCLVSGUEJT-SHTZXODSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n1c(c(cnc1NCCCC)c2ncccc2)NC3CCC(O)CC3 | OpenEye OEToolkits 1.7.6 | CCCCNc1ncc(c(n1)NC2CCC(CC2)O)c3ccccn3 | CACTVS 3.385 | CCCCNc1ncc(c(N[CH]2CC[CH](O)CC2)n1)c3ccccn3 | CACTVS 3.385 | CCCCNc1ncc(c(N[C@@H]2CC[C@@H](O)CC2)n1)c3ccccn3 |
|
Formula | C19 H27 N5 O |
Name | trans-4-{[2-(butylamino)-5-(pyridin-2-yl)pyrimidin-4-yl]amino}cyclohexanol |
ChEMBL | CHEMBL3092785 |
DrugBank | |
ZINC |
|
PDB chain | 4m3q Chain B Residue 904
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|