Structure of PDB 4m1y Chain B Binding Site BS01 |
|
|
Ligand ID | 21S |
InChI | InChI=1S/C15H19Cl2N5O3S2/c1-2-27(24,25)21-9-3-5-22(6-4-9)12(23)8-18-13-10(16)7-11(17)14-15(13)20-26-19-14/h7,9,18,21H,2-6,8H2,1H3 |
InChIKey | YIZDVHQIBSLIHU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(NC3CCN(C(=O)CNc1c(Cl)cc(Cl)c2nsnc12)CC3)CC | CACTVS 3.385 | CC[S](=O)(=O)NC1CCN(CC1)C(=O)CNc2c(Cl)cc(Cl)c3nsnc23 | OpenEye OEToolkits 1.7.6 | CCS(=O)(=O)NC1CCN(CC1)C(=O)CNc2c(cc(c3c2nsn3)Cl)Cl |
|
Formula | C15 H19 Cl2 N5 O3 S2 |
Name | N-{1-[N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)glycyl]piperidin-4-yl}ethanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921264
|
PDB chain | 4m1y Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.5.2: small monomeric GTPase. |
|
|
|