Structure of PDB 4l4z Chain B Binding Site BS01 |
|
|
Ligand ID | D5X |
InChI | InChI=1S/C5H11O8P/c1-3(6)5(8,9)4(7)2-13-14(10,11)12/h4,7-9H,2H2,1H3,(H2,10,11,12)/t4-/m0/s1 |
InChIKey | FWCIRYJUXQBEHG-BYPYZUCNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)C(O)(O)[CH](O)CO[P](O)(O)=O | CACTVS 3.385 | CC(=O)C(O)(O)[C@@H](O)CO[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | CC(=O)C([C@H](COP(=O)(O)O)O)(O)O | ACDLabs 12.01 | O=P(OCC(O)C(O)(O)C(=O)C)(O)O | OpenEye OEToolkits 1.7.6 | CC(=O)C(C(COP(=O)(O)O)O)(O)O |
|
Formula | C5 H11 O8 P |
Name | (2S)-2,3,3-trihydroxy-4-oxopentyl dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208782
|
PDB chain | 4l4z Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|